C17H20ClN5O8S — CID 14230748
methyl (2R,3R)-3-[[(2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-(1-methoxy-2-methyl-1-oxopropan-2-yl)oxyiminoacetyl]amino]-4-oxoazetidine-2-carboxylate (PubChem CID 14230748) has the molecular formula C17H20ClN5O8S and a molecular weight of 489.89 g/mol. Its IUPAC name is methyl (2R,3R)-3-[[(2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-(1-methoxy-2-methyl-1-oxopropan-2-yl)oxyiminoacetyl]amino]-4-oxoazetidine-2-carboxylate.
| Compound Name | methyl (2R,3R)-3-[[(2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-(1-methoxy-2-methyl-1-oxopropan-2-yl)oxyiminoacetyl]amino]-4-oxoazetidine-2-carboxylate |
|---|---|
| PubChem CID | 14230748 |
| Molecular Formula | C17H20ClN5O8S |
| Molecular Weight | 489.89 g/mol |
| Exact Mass | 489.07 |
| IUPAC Name | methyl (2R,3R)-3-[[(2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-(1-methoxy-2-methyl-1-oxopropan-2-yl)oxyiminoacetyl]amino]-4-oxoazetidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1NC(=O)[C@@H]1NC(=O)/C(=N\OC(C)(C)C(=O)OC)c1csc(NC(=O)CCl)n1 |
| InChI | InChI=1S/C17H20ClN5O8S/c1-17(2,15(28)30-4)31-23-9(7-6-32-16(19-7)20-8(24)5-18)12(25)21-10-11(14(27)29-3)22-13(10)26/h6,10-11H,5H2,1-4H3,(H,21,25)(H,22,26)(H,19,20,24)/b23-9-/t10-,11-/m1/s1 |
| InChIKey | IHTBSZCZMGZDSY-PRLSCHEUSA-N |
| XLogP | -0.85 |
| TPSA | 174.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.89 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|