C15H18ClN5O6S — CID 54150686
[(2S,3S)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-propan-2-yloxyiminoacetyl]amino]-4-oxoazetidin-2-yl] acetate (PubChem CID 54150686) has the molecular formula C15H18ClN5O6S and a molecular weight of 431.86 g/mol. Its IUPAC name is [(2S,3S)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-propan-2-yloxyiminoacetyl]amino]-4-oxoazetidin-2-yl] acetate.
| Compound Name | [(2S,3S)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-propan-2-yloxyiminoacetyl]amino]-4-oxoazetidin-2-yl] acetate |
|---|---|
| PubChem CID | 54150686 |
| Molecular Formula | C15H18ClN5O6S |
| Molecular Weight | 431.86 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | [(2S,3S)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-propan-2-yloxyiminoacetyl]amino]-4-oxoazetidin-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1NC(=O)[C@H]1NC(=O)C(=NOC(C)C)c1csc(NC(=O)CCl)n1 |
| InChI | InChI=1S/C15H18ClN5O6S/c1-6(2)27-21-10(8-5-28-15(17-8)18-9(23)4-16)12(24)19-11-13(25)20-14(11)26-7(3)22/h5-6,11,14H,4H2,1-3H3,(H,19,24)(H,20,25)(H,17,18,23)/t11-,14+/m1/s1 |
| InChIKey | OHNGCWLERYAKFP-RISCZKNCSA-N |
| XLogP | -0.05 |
| TPSA | 148.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.86 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|