C15H15ClN8O6S — CID 173430997
methyl 1-[(2R,3S)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidin-2-yl]triazole-4-carboxylate (PubChem CID 173430997) has the molecular formula C15H15ClN8O6S and a molecular weight of 470.86 g/mol. Its IUPAC name is methyl 1-[(2R,3S)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidin-2-yl]triazole-4-carboxylate.
| Compound Name | methyl 1-[(2R,3S)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidin-2-yl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 173430997 |
| Molecular Formula | C15H15ClN8O6S |
| Molecular Weight | 470.86 g/mol |
| Exact Mass | 470.05 |
| IUPAC Name | methyl 1-[(2R,3S)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidin-2-yl]triazole-4-carboxylate |
| SMILES | CON=C(C(=O)N[C@@H]1C(=O)N[C@@H]1n1cc(C(=O)OC)nn1)c1csc(NC(=O)CCl)n1 |
| InChI | InChI=1S/C15H15ClN8O6S/c1-29-14(28)6-4-24(23-21-6)11-10(13(27)20-11)19-12(26)9(22-30-2)7-5-31-15(17-7)18-8(25)3-16/h4-5,10-11H,3H2,1-2H3,(H,19,26)(H,20,27)(H,17,18,25)/t10-,11+/m0/s1 |
| InChIKey | MXLTZPGYEHFNHS-WDEREUQCSA-N |
| XLogP | -1.14 |
| TPSA | 178.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.86 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|