C16H17ClN8O6S — CID 173410358
ethyl 3-[(2S,3S)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidin-2-yl]triazole-4-carboxylate (PubChem CID 173410358) has the molecular formula C16H17ClN8O6S and a molecular weight of 484.88 g/mol. Its IUPAC name is ethyl 3-[(2S,3S)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidin-2-yl]triazole-4-carboxylate.
| Compound Name | ethyl 3-[(2S,3S)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidin-2-yl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 173410358 |
| Molecular Formula | C16H17ClN8O6S |
| Molecular Weight | 484.88 g/mol |
| Exact Mass | 484.07 |
| IUPAC Name | ethyl 3-[(2S,3S)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidin-2-yl]triazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnnn1[C@@H]1NC(=O)[C@H]1NC(=O)C(=NOC)c1csc(NC(=O)CCl)n1 |
| InChI | InChI=1S/C16H17ClN8O6S/c1-3-31-15(29)8-5-18-24-25(8)12-11(14(28)22-12)21-13(27)10(23-30-2)7-6-32-16(19-7)20-9(26)4-17/h5-6,11-12H,3-4H2,1-2H3,(H,21,27)(H,22,28)(H,19,20,26)/t11-,12-/m0/s1 |
| InChIKey | JGRZAFBJXSUWFC-RYUDHWBXSA-N |
| XLogP | -0.75 |
| TPSA | 178.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.88 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|