C15H16ClN5O8S — CID 21244525
methyl 3-[[(2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-(2-methoxy-2-oxoethoxy)iminoacetyl]amino]-4-oxoazetidine-2-carboxylate (PubChem CID 21244525) has the molecular formula C15H16ClN5O8S and a molecular weight of 461.84 g/mol. Its IUPAC name is methyl 3-[[(2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-(2-methoxy-2-oxoethoxy)iminoacetyl]amino]-4-oxoazetidine-2-carboxylate.
| Compound Name | methyl 3-[[(2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-(2-methoxy-2-oxoethoxy)iminoacetyl]amino]-4-oxoazetidine-2-carboxylate |
|---|---|
| PubChem CID | 21244525 |
| Molecular Formula | C15H16ClN5O8S |
| Molecular Weight | 461.84 g/mol |
| Exact Mass | 461.04 |
| IUPAC Name | methyl 3-[[(2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-(2-methoxy-2-oxoethoxy)iminoacetyl]amino]-4-oxoazetidine-2-carboxylate |
| SMILES | COC(=O)CO/N=C(\C(=O)NC1C(=O)NC1C(=O)OC)c1csc(NC(=O)CCl)n1 |
| InChI | InChI=1S/C15H16ClN5O8S/c1-27-8(23)4-29-21-9(6-5-30-15(17-6)18-7(22)3-16)12(24)19-10-11(14(26)28-2)20-13(10)25/h5,10-11H,3-4H2,1-2H3,(H,19,24)(H,20,25)(H,17,18,22)/b21-9- |
| InChIKey | YQIBNDQEMDTULD-NKVSQWTQSA-N |
| XLogP | -1.63 |
| TPSA | 174.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.84 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|