C23H23ClN6O10S — CID 14230744
methyl 3-[[(2E)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-[2-methyl-1-[(4-nitrophenyl)methoxy]-1-oxopropan-2-yl]oxyiminoacetyl]amino]-4-oxoazetidine-2-carboxylate (PubChem CID 14230744) has the molecular formula C23H23ClN6O10S and a molecular weight of 610.99 g/mol. Its IUPAC name is methyl 3-[[(2E)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-[2-methyl-1-[(4-nitrophenyl)methoxy]-1-oxopropan-2-yl]oxyiminoacetyl]amino]-4-oxoazetidine-2-carboxylate.
| Compound Name | methyl 3-[[(2E)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-[2-methyl-1-[(4-nitrophenyl)methoxy]-1-oxopropan-2-yl]oxyiminoacetyl]amino]-4-oxoazetidine-2-carboxylate |
|---|---|
| PubChem CID | 14230744 |
| Molecular Formula | C23H23ClN6O10S |
| Molecular Weight | 610.99 g/mol |
| Exact Mass | 610.09 |
| IUPAC Name | methyl 3-[[(2E)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-[2-methyl-1-[(4-nitrophenyl)methoxy]-1-oxopropan-2-yl]oxyiminoacetyl]amino]-4-oxoazetidine-2-carboxylate |
| SMILES | COC(=O)C1NC(=O)C1NC(=O)/C(=N/OC(C)(C)C(=O)OCc1ccc([N+](=O)[O-])cc1)c1csc(NC(=O)CCl)n1 |
| InChI | InChI=1S/C23H23ClN6O10S/c1-23(2,21(35)39-9-11-4-6-12(7-5-11)30(36)37)40-29-15(13-10-41-22(25-13)26-14(31)8-24)18(32)27-16-17(20(34)38-3)28-19(16)33/h4-7,10,16-17H,8-9H2,1-3H3,(H,27,32)(H,28,33)(H,25,26,31)/b29-15+ |
| InChIKey | WJQASPHAVWFWJS-WKULSOCRSA-N |
| XLogP | 0.63 |
| TPSA | 217.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.99 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|