C24H25ClN6O10S — CID 88627659
(4-nitrophenyl)methyl 2-[(Z)-[2-[[2-(acetyloxymethyl)-4-oxoazetidin-3-yl]amino]-1-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-oxoethylidene]amino]oxy-2-methylpropanoate (PubChem CID 88627659) has the molecular formula C24H25ClN6O10S and a molecular weight of 625.02 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-[(Z)-[2-[[2-(acetyloxymethyl)-4-oxoazetidin-3-yl]amino]-1-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-oxoethylidene]amino]oxy-2-methylpropanoate.
| Compound Name | (4-nitrophenyl)methyl 2-[(Z)-[2-[[2-(acetyloxymethyl)-4-oxoazetidin-3-yl]amino]-1-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-oxoethylidene]amino]oxy-2-methylpropanoate |
|---|---|
| PubChem CID | 88627659 |
| Molecular Formula | C24H25ClN6O10S |
| Molecular Weight | 625.02 g/mol |
| Exact Mass | 624.10 |
| IUPAC Name | (4-nitrophenyl)methyl 2-[(Z)-[2-[[2-(acetyloxymethyl)-4-oxoazetidin-3-yl]amino]-1-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-oxoethylidene]amino]oxy-2-methylpropanoate |
| SMILES | CC(=O)OCC1NC(=O)C1NC(=O)/C(=N\OC(C)(C)C(=O)OCc1ccc([N+](=O)[O-])cc1)c1csc(NC(=O)CCl)n1 |
| InChI | InChI=1S/C24H25ClN6O10S/c1-12(32)39-10-15-18(20(34)26-15)29-21(35)19(16-11-42-23(27-16)28-17(33)8-25)30-41-24(2,3)22(36)40-9-13-4-6-14(7-5-13)31(37)38/h4-7,11,15,18H,8-10H2,1-3H3,(H,26,34)(H,29,35)(H,27,28,33)/b30-19- |
| InChIKey | IVWIRQSGSKRSLO-FSGOGVSDSA-N |
| XLogP | 1.02 |
| TPSA | 217.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.02 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|