C18H17ClN4O8S — CID 54058058
2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-[2-methyl-1-[(4-nitrophenyl)methoxy]-1-oxopropan-2-yl]oxyiminoacetic acid (PubChem CID 54058058) has the molecular formula C18H17ClN4O8S and a molecular weight of 484.87 g/mol. Its IUPAC name is 2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-[2-methyl-1-[(4-nitrophenyl)methoxy]-1-oxopropan-2-yl]oxyiminoacetic acid.
| Compound Name | 2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-[2-methyl-1-[(4-nitrophenyl)methoxy]-1-oxopropan-2-yl]oxyiminoacetic acid |
|---|---|
| PubChem CID | 54058058 |
| Molecular Formula | C18H17ClN4O8S |
| Molecular Weight | 484.87 g/mol |
| Exact Mass | 484.05 |
| IUPAC Name | 2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-[2-methyl-1-[(4-nitrophenyl)methoxy]-1-oxopropan-2-yl]oxyiminoacetic acid |
| SMILES | CC(C)(ON=C(C(=O)O)c1csc(NC(=O)CCl)n1)C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H17ClN4O8S/c1-18(2,16(27)30-8-10-3-5-11(6-4-10)23(28)29)31-22-14(15(25)26)12-9-32-17(20-12)21-13(24)7-19/h3-6,9H,7-8H2,1-2H3,(H,25,26)(H,20,21,24) |
| InChIKey | LXRHAISCAFVEIS-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 170.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.87 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|