C21H22N6O12S2 — CID 88629247
(2R,3R)-3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[2-methyl-1-[(4-nitrophenyl)methoxy]-1-oxopropan-2-yl]oxyiminoacetyl]amino]-2-methoxycarbonyl-4-oxoazetidine-1-sulfonic acid (PubChem CID 88629247) has the molecular formula C21H22N6O12S2 and a molecular weight of 614.57 g/mol. Its IUPAC name is (2R,3R)-3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[2-methyl-1-[(4-nitrophenyl)methoxy]-1-oxopropan-2-yl]oxyiminoacetyl]amino]-2-methoxycarbonyl-4-oxoazetidine-1-sulfonic acid.
| Compound Name | (2R,3R)-3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[2-methyl-1-[(4-nitrophenyl)methoxy]-1-oxopropan-2-yl]oxyiminoacetyl]amino]-2-methoxycarbonyl-4-oxoazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 88629247 |
| Molecular Formula | C21H22N6O12S2 |
| Molecular Weight | 614.57 g/mol |
| Exact Mass | 614.07 |
| IUPAC Name | (2R,3R)-3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[2-methyl-1-[(4-nitrophenyl)methoxy]-1-oxopropan-2-yl]oxyiminoacetyl]amino]-2-methoxycarbonyl-4-oxoazetidine-1-sulfonic acid |
| SMILES | COC(=O)[C@H]1[C@@H](NC(=O)/C(=N\OC(C)(C)C(=O)OCc2ccc([N+](=O)[O-])cc2)c2csc(N)n2)C(=O)N1S(=O)(=O)O |
| InChI | InChI=1S/C21H22N6O12S2/c1-21(2,19(31)38-8-10-4-6-11(7-5-10)27(32)33)39-25-13(12-9-40-20(22)23-12)16(28)24-14-15(18(30)37-3)26(17(14)29)41(34,35)36/h4-7,9,14-15H,8H2,1-3H3,(H2,22,23)(H,24,28)(H,34,35,36)/b25-13-/t14-,15-/m1/s1 |
| InChIKey | AIZGFISLPIWATE-NYAJRYLLSA-N |
| XLogP | -0.45 |
| TPSA | 260.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.57 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|