C21H21N7O10S2 — CID 88628898
(2S,3R)-3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[2-methyl-1-[(4-nitrophenyl)methoxy]-1-oxopropan-2-yl]oxyiminoacetyl]amino]-2-(cyanomethyl)-4-oxoazetidine-1-sulfonic acid (PubChem CID 88628898) has the molecular formula C21H21N7O10S2 and a molecular weight of 595.57 g/mol. Its IUPAC name is (2S,3R)-3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[2-methyl-1-[(4-nitrophenyl)methoxy]-1-oxopropan-2-yl]oxyiminoacetyl]amino]-2-(cyanomethyl)-4-oxoazetidine-1-sulfonic acid.
| Compound Name | (2S,3R)-3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[2-methyl-1-[(4-nitrophenyl)methoxy]-1-oxopropan-2-yl]oxyiminoacetyl]amino]-2-(cyanomethyl)-4-oxoazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 88628898 |
| Molecular Formula | C21H21N7O10S2 |
| Molecular Weight | 595.57 g/mol |
| Exact Mass | 595.08 |
| IUPAC Name | (2S,3R)-3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[2-methyl-1-[(4-nitrophenyl)methoxy]-1-oxopropan-2-yl]oxyiminoacetyl]amino]-2-(cyanomethyl)-4-oxoazetidine-1-sulfonic acid |
| SMILES | CC(C)(O/N=C(\C(=O)N[C@H]1C(=O)N(S(=O)(=O)O)[C@H]1CC#N)c1csc(N)n1)C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H21N7O10S2/c1-21(2,19(31)37-9-11-3-5-12(6-4-11)28(32)33)38-26-15(13-10-39-20(23)24-13)17(29)25-16-14(7-8-22)27(18(16)30)40(34,35)36/h3-6,10,14,16H,7,9H2,1-2H3,(H2,23,24)(H,25,29)(H,34,35,36)/b26-15-/t14-,16+/m0/s1 |
| InChIKey | CYBWVJRWJNELGQ-SDLZYRCGSA-N |
| XLogP | 0.29 |
| TPSA | 257.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.57 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|