C14H16N6O8S2 — CID 88628637
2-[(E)-[1-(2-amino-1,3-thiazol-4-yl)-2-[[(2S,3R)-2-(cyanomethyl)-4-oxo-1-sulfoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxy-2-methylpropanoic acid (PubChem CID 88628637) has the molecular formula C14H16N6O8S2 and a molecular weight of 460.45 g/mol. Its IUPAC name is 2-[(E)-[1-(2-amino-1,3-thiazol-4-yl)-2-[[(2S,3R)-2-(cyanomethyl)-4-oxo-1-sulfoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxy-2-methylpropanoic acid.
| Compound Name | 2-[(E)-[1-(2-amino-1,3-thiazol-4-yl)-2-[[(2S,3R)-2-(cyanomethyl)-4-oxo-1-sulfoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 88628637 |
| Molecular Formula | C14H16N6O8S2 |
| Molecular Weight | 460.45 g/mol |
| Exact Mass | 460.05 |
| IUPAC Name | 2-[(E)-[1-(2-amino-1,3-thiazol-4-yl)-2-[[(2S,3R)-2-(cyanomethyl)-4-oxo-1-sulfoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxy-2-methylpropanoic acid |
| SMILES | CC(C)(O/N=C(/C(=O)N[C@H]1C(=O)N(S(=O)(=O)O)[C@H]1CC#N)c1csc(N)n1)C(=O)O |
| InChI | InChI=1S/C14H16N6O8S2/c1-14(2,12(23)24)28-19-8(6-5-29-13(16)17-6)10(21)18-9-7(3-4-15)20(11(9)22)30(25,26)27/h5,7,9H,3H2,1-2H3,(H2,16,17)(H,18,21)(H,23,24)(H,25,26,27)/b19-8+/t7-,9+/m0/s1 |
| InChIKey | IXQAXEOLPPJENF-XGINMKTKSA-N |
| XLogP | -1.28 |
| TPSA | 225.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.45 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|