C15H16ClN5O6S — CID 88628865
methyl (2R,3R)-3-[[(2E)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-prop-2-enoxyiminoacetyl]amino]-4-oxoazetidine-2-carboxylate (PubChem CID 88628865) has the molecular formula C15H16ClN5O6S and a molecular weight of 429.84 g/mol. Its IUPAC name is methyl (2R,3R)-3-[[(2E)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-prop-2-enoxyiminoacetyl]amino]-4-oxoazetidine-2-carboxylate.
| Compound Name | methyl (2R,3R)-3-[[(2E)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-prop-2-enoxyiminoacetyl]amino]-4-oxoazetidine-2-carboxylate |
|---|---|
| PubChem CID | 88628865 |
| Molecular Formula | C15H16ClN5O6S |
| Molecular Weight | 429.84 g/mol |
| Exact Mass | 429.05 |
| IUPAC Name | methyl (2R,3R)-3-[[(2E)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-prop-2-enoxyiminoacetyl]amino]-4-oxoazetidine-2-carboxylate |
| SMILES | C=CCO/N=C(/C(=O)N[C@H]1C(=O)N[C@H]1C(=O)OC)c1csc(NC(=O)CCl)n1 |
| InChI | InChI=1S/C15H16ClN5O6S/c1-3-4-27-21-9(7-6-28-15(17-7)18-8(22)5-16)12(23)19-10-11(14(25)26-2)20-13(10)24/h3,6,10-11H,1,4-5H2,2H3,(H,19,23)(H,20,24)(H,17,18,22)/b21-9+/t10-,11-/m1/s1 |
| InChIKey | KKLWIFXHNIGQMH-FRFNHQSMSA-N |
| XLogP | -0.62 |
| TPSA | 148.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.84 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|