C9H10Cl3N3O3S — CID 19869087
(2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-ethoxyiminoacetyl chloride;hydrochloride (PubChem CID 19869087) has the molecular formula C9H10Cl3N3O3S and a molecular weight of 346.62 g/mol. Its IUPAC name is (2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-ethoxyiminoacetyl chloride;hydrochloride.
| Compound Name | (2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-ethoxyiminoacetyl chloride;hydrochloride |
|---|---|
| PubChem CID | 19869087 |
| Molecular Formula | C9H10Cl3N3O3S |
| Molecular Weight | 346.62 g/mol |
| Exact Mass | 344.95 |
| IUPAC Name | (2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-ethoxyiminoacetyl chloride;hydrochloride |
| SMILES | CCO/N=C(\C(=O)Cl)c1csc(NC(=O)CCl)n1.Cl |
| InChI | InChI=1S/C9H9Cl2N3O3S.ClH/c1-2-17-14-7(8(11)16)5-4-18-9(12-5)13-6(15)3-10;/h4H,2-3H2,1H3,(H,12,13,15);1H/b14-7-; |
| InChIKey | FRWSDUZIECGUEU-KIUKIJHYSA-N |
| XLogP | 2.25 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.62 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|