2-ethoxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetic acid

C8H9N3O4S — CID 54458077

IUPAC2-ethoxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetic acid
SMILESCCON=C(C(=O)O)c1csc(NC=O)n1
InChIInChI=1S/C8H9N3O4S/c1-2-15-11-6(7(13)14)5-3-16-8(10-5)9-4-12/h3-4H,2H2,1H3,(H,13,14)(H,9,10,12)
InChIKeyWZPOBANFTJLEHD-UHFFFAOYSA-N
MW243.24 g/mol
LogP0.54
Rot. Bonds6

About 2-ethoxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetic acid

2-ethoxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetic acid (PubChem CID 54458077) has the molecular formula C8H9N3O4S and a molecular weight of 243.24 g/mol. Its IUPAC name is 2-ethoxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetic acid.

Molecular Properties

Compound Name2-ethoxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetic acid
PubChem CID54458077
Molecular FormulaC8H9N3O4S
Molecular Weight243.24 g/mol
Exact Mass243.03
IUPAC Name2-ethoxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetic acid
SMILESCCON=C(C(=O)O)c1csc(NC=O)n1
InChIInChI=1S/C8H9N3O4S/c1-2-15-11-6(7(13)14)5-3-16-8(10-5)9-4-12/h3-4H,2H2,1H3,(H,13,14)(H,9,10,12)
InChIKeyWZPOBANFTJLEHD-UHFFFAOYSA-N
XLogP0.54
TPSA100.88 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds6
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500243.24
LogP ≤ 50.54
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-ethoxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethoxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetic acid?
The IUPAC name of 2-ethoxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetic acid (CID 54458077) is 2-ethoxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetic acid.
What is the SMILES notation for 2-ethoxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetic acid?
The canonical SMILES for 2-ethoxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetic acid is CCON=C(C(=O)O)c1csc(NC=O)n1.
What is the InChIKey of 2-ethoxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetic acid?
The InChIKey is WZPOBANFTJLEHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O4S/c1-2-15-11-6(7(13)14)5-3-16-8(10-5)9-4-12/h3-4H,2H2,1H3,(H,13,14)(H,9,10,12).
What are the key properties of 2-ethoxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetic acid?
2-ethoxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetic acid has a molecular weight of 243.24 g/mol, XLogP of 0.54, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetic acid is sourced from PubChem (CID 54458077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).