C8H9N3O4S — CID 54458077
2-ethoxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetic acid (PubChem CID 54458077) has the molecular formula C8H9N3O4S and a molecular weight of 243.24 g/mol. Its IUPAC name is 2-ethoxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetic acid.
| Compound Name | 2-ethoxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetic acid |
|---|---|
| PubChem CID | 54458077 |
| Molecular Formula | C8H9N3O4S |
| Molecular Weight | 243.24 g/mol |
| Exact Mass | 243.03 |
| IUPAC Name | 2-ethoxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetic acid |
| SMILES | CCON=C(C(=O)O)c1csc(NC=O)n1 |
| InChI | InChI=1S/C8H9N3O4S/c1-2-15-11-6(7(13)14)5-3-16-8(10-5)9-4-12/h3-4H,2H2,1H3,(H,13,14)(H,9,10,12) |
| InChIKey | WZPOBANFTJLEHD-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.24 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|