C15H15N5O7S2 — CID 57128342
(6S)-7-[[2-ethoxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetyl]amino]-3,8-dioxo-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylic acid (PubChem CID 57128342) has the molecular formula C15H15N5O7S2 and a molecular weight of 441.45 g/mol. Its IUPAC name is (6S)-7-[[2-ethoxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetyl]amino]-3,8-dioxo-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylic acid.
| Compound Name | (6S)-7-[[2-ethoxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetyl]amino]-3,8-dioxo-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylic acid |
|---|---|
| PubChem CID | 57128342 |
| Molecular Formula | C15H15N5O7S2 |
| Molecular Weight | 441.45 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | (6S)-7-[[2-ethoxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetyl]amino]-3,8-dioxo-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylic acid |
| SMILES | CCON=C(C(=O)NC1C(=O)N2C(C(=O)O)C(=O)CS[C@@H]12)c1csc(NC=O)n1 |
| InChI | InChI=1S/C15H15N5O7S2/c1-2-27-19-8(6-3-29-15(17-6)16-5-21)11(23)18-9-12(24)20-10(14(25)26)7(22)4-28-13(9)20/h3,5,9-10,13H,2,4H2,1H3,(H,18,23)(H,25,26)(H,16,17,21)/t9?,10?,13-/m0/s1 |
| InChIKey | WVMDGGCOAMMATI-ZPPKWKGLSA-N |
| XLogP | -1.13 |
| TPSA | 167.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.45 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|