C18H21N5O6S2 — CID 173389501
(6R)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-pentoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-3-carboxylic acid (PubChem CID 173389501) has the molecular formula C18H21N5O6S2 and a molecular weight of 467.53 g/mol. Its IUPAC name is (6R)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-pentoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-3-carboxylic acid.
| Compound Name | (6R)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-pentoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-3-carboxylic acid |
|---|---|
| PubChem CID | 173389501 |
| Molecular Formula | C18H21N5O6S2 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.09 |
| IUPAC Name | (6R)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-pentoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-3-carboxylic acid |
| SMILES | CCCCCON=C(C(=O)NC1C(=O)N2C=C(C(=O)O)CS[C@H]12)c1csc(NC=O)n1 |
| InChI | InChI=1S/C18H21N5O6S2/c1-2-3-4-5-29-22-12(11-8-31-18(20-11)19-9-24)14(25)21-13-15(26)23-6-10(17(27)28)7-30-16(13)23/h6,8-9,13,16H,2-5,7H2,1H3,(H,21,25)(H,27,28)(H,19,20,24)/t13?,16-/m1/s1 |
| InChIKey | HWGDYLBEBVVUNM-FQNRMIAFSA-N |
| XLogP | 0.99 |
| TPSA | 150.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|