C22H29N7O6S2 — CID 88730924
[(6S)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-propoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl 4-methylpiperazine-1-carboxylate (PubChem CID 88730924) has the molecular formula C22H29N7O6S2 and a molecular weight of 551.65 g/mol. Its IUPAC name is [(6S)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-propoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl 4-methylpiperazine-1-carboxylate.
| Compound Name | [(6S)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-propoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl 4-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 88730924 |
| Molecular Formula | C22H29N7O6S2 |
| Molecular Weight | 551.65 g/mol |
| Exact Mass | 551.16 |
| IUPAC Name | [(6S)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-propoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl 4-methylpiperazine-1-carboxylate |
| SMILES | CCCON=C(C(=O)NC1C(=O)N2C=C(COC(=O)N3CCN(C)CC3)CS[C@@H]12)c1csc(NC=O)n1 |
| InChI | InChI=1S/C22H29N7O6S2/c1-3-8-35-26-16(15-12-37-21(24-15)23-13-30)18(31)25-17-19(32)29-9-14(11-36-20(17)29)10-34-22(33)28-6-4-27(2)5-7-28/h9,12-13,17,20H,3-8,10-11H2,1-2H3,(H,25,31)(H,23,24,30)/t17?,20-/m0/s1 |
| InChIKey | KGOVSHJDPMIPGX-OZBJMMHXSA-N |
| XLogP | 0.51 |
| TPSA | 145.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.65 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|