C20H25N7O6S2 — CID 88729356
[(6S)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl 4-methylpiperazine-1-carboxylate (PubChem CID 88729356) has the molecular formula C20H25N7O6S2 and a molecular weight of 523.60 g/mol. Its IUPAC name is [(6S)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl 4-methylpiperazine-1-carboxylate.
| Compound Name | [(6S)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl 4-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 88729356 |
| Molecular Formula | C20H25N7O6S2 |
| Molecular Weight | 523.60 g/mol |
| Exact Mass | 523.13 |
| IUPAC Name | [(6S)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl 4-methylpiperazine-1-carboxylate |
| SMILES | CON=C(C(=O)NC1C(=O)N2C=C(COC(=O)N3CCN(C)CC3)CS[C@@H]12)c1csc(NC=O)n1 |
| InChI | InChI=1S/C20H25N7O6S2/c1-25-3-5-26(6-4-25)20(31)33-8-12-7-27-17(30)15(18(27)34-9-12)23-16(29)14(24-32-2)13-10-35-19(22-13)21-11-28/h7,10-11,15,18H,3-6,8-9H2,1-2H3,(H,23,29)(H,21,22,28)/t15?,18-/m0/s1 |
| InChIKey | GDQVPJRQKGHSCC-PKHIMPSTSA-N |
| XLogP | -0.27 |
| TPSA | 145.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.60 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|