C21H20N7O4S2+ — CID 88622174
2-(2-amino-1,3-thiazol-4-yl)-2-methoxyimino-N-[(6S,7R)-3-[[4-(1,3-oxazol-5-yl)pyridin-1-ium-1-yl]methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]acetamide (PubChem CID 88622174) has the molecular formula C21H20N7O4S2+ and a molecular weight of 498.57 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-2-methoxyimino-N-[(6S,7R)-3-[[4-(1,3-oxazol-5-yl)pyridin-1-ium-1-yl]methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]acetamide.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-2-methoxyimino-N-[(6S,7R)-3-[[4-(1,3-oxazol-5-yl)pyridin-1-ium-1-yl]methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]acetamide |
|---|---|
| PubChem CID | 88622174 |
| Molecular Formula | C21H20N7O4S2+ |
| Molecular Weight | 498.57 g/mol |
| Exact Mass | 498.10 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-2-methoxyimino-N-[(6S,7R)-3-[[4-(1,3-oxazol-5-yl)pyridin-1-ium-1-yl]methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]acetamide |
| SMILES | CON=C(C(=O)N[C@@H]1C(=O)N2C=C(C[n+]3ccc(-c4cnco4)cc3)CS[C@@H]12)c1csc(N)n1 |
| InChI | InChI=1S/C21H19N7O4S2/c1-31-26-16(14-10-34-21(22)24-14)18(29)25-17-19(30)28-8-12(9-33-20(17)28)7-27-4-2-13(3-5-27)15-6-23-11-32-15/h2-6,8,10-11,17,20H,7,9H2,1H3,(H2-,22,24,25,29)/p+1/t17-,20+/m1/s1 |
| InChIKey | KDKTUYCSPWUOAY-XLIONFOSSA-O |
| XLogP | 1.00 |
| TPSA | 139.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.57 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|