C21H20N9O5S2+ — CID 56626999
(6S,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-[[4-(1,2,4-triazol-1-yl)pyridin-1-ium-1-yl]methyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 56626999) has the molecular formula C21H20N9O5S2+ and a molecular weight of 542.58 g/mol. Its IUPAC name is (6S,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-[[4-(1,2,4-triazol-1-yl)pyridin-1-ium-1-yl]methyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-[[4-(1,2,4-triazol-1-yl)pyridin-1-ium-1-yl]methyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 56626999 |
| Molecular Formula | C21H20N9O5S2+ |
| Molecular Weight | 542.58 g/mol |
| Exact Mass | 542.10 |
| IUPAC Name | (6S,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-[[4-(1,2,4-triazol-1-yl)pyridin-1-ium-1-yl]methyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CON=C(C(=O)N[C@@H]1C(=O)N2C(C(=O)O)=C(C[n+]3ccc(-n4cncn4)cc3)CS[C@@H]12)c1csc(N)n1 |
| InChI | InChI=1S/C21H19N9O5S2/c1-35-27-14(13-8-37-21(22)25-13)17(31)26-15-18(32)30-16(20(33)34)11(7-36-19(15)30)6-28-4-2-12(3-5-28)29-10-23-9-24-29/h2-5,8-10,15,19H,6-7H2,1H3,(H3-,22,25,26,31,33,34)/p+1/t15-,19+/m1/s1 |
| InChIKey | WHCFAQGRLRLYQQ-BEFAXECRSA-O |
| XLogP | -0.62 |
| TPSA | 181.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.58 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|