C17H16N6O3S3 — CID 173386760
2-(2-amino-1,3-thiazol-4-yl)-2-methoxyimino-N-[(6R)-8-oxo-3-[2-(1,3-thiazol-4-yl)ethenyl]-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]acetamide (PubChem CID 173386760) has the molecular formula C17H16N6O3S3 and a molecular weight of 448.56 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-2-methoxyimino-N-[(6R)-8-oxo-3-[2-(1,3-thiazol-4-yl)ethenyl]-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]acetamide.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-2-methoxyimino-N-[(6R)-8-oxo-3-[2-(1,3-thiazol-4-yl)ethenyl]-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]acetamide |
|---|---|
| PubChem CID | 173386760 |
| Molecular Formula | C17H16N6O3S3 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.04 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-2-methoxyimino-N-[(6R)-8-oxo-3-[2-(1,3-thiazol-4-yl)ethenyl]-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]acetamide |
| SMILES | CON=C(C(=O)NC1C(=O)N2C=C(C=Cc3cscn3)CS[C@H]12)c1csc(N)n1 |
| InChI | InChI=1S/C17H16N6O3S3/c1-26-22-12(11-7-29-17(18)20-11)14(24)21-13-15(25)23-4-9(5-28-16(13)23)2-3-10-6-27-8-19-10/h2-4,6-8,13,16H,5H2,1H3,(H2,18,20)(H,21,24)/t13?,16-/m1/s1 |
| InChIKey | WPRGLFRDPFDRTE-FQNRMIAFSA-N |
| XLogP | 1.53 |
| TPSA | 122.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|