C24H21N5O3S3 — CID 54319917
2-(2-amino-1,3-thiazol-4-yl)-2-methoxyimino-N-[(6S,7R)-8-oxo-3-(2-phenylphenyl)sulfanyl-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]acetamide (PubChem CID 54319917) has the molecular formula C24H21N5O3S3 and a molecular weight of 523.67 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-2-methoxyimino-N-[(6S,7R)-8-oxo-3-(2-phenylphenyl)sulfanyl-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]acetamide.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-2-methoxyimino-N-[(6S,7R)-8-oxo-3-(2-phenylphenyl)sulfanyl-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]acetamide |
|---|---|
| PubChem CID | 54319917 |
| Molecular Formula | C24H21N5O3S3 |
| Molecular Weight | 523.67 g/mol |
| Exact Mass | 523.08 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-2-methoxyimino-N-[(6S,7R)-8-oxo-3-(2-phenylphenyl)sulfanyl-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]acetamide |
| SMILES | CON=C(C(=O)N[C@@H]1C(=O)N2C=C(Sc3ccccc3-c3ccccc3)CS[C@@H]12)c1csc(N)n1 |
| InChI | InChI=1S/C24H21N5O3S3/c1-32-28-19(17-13-34-24(25)26-17)21(30)27-20-22(31)29-11-15(12-33-23(20)29)35-18-10-6-5-9-16(18)14-7-3-2-4-8-14/h2-11,13,20,23H,12H2,1H3,(H2,25,26)(H,27,30)/t20-,23+/m1/s1 |
| InChIKey | SQXAPWWAZUXEKG-OFNKIYASSA-N |
| XLogP | 3.78 |
| TPSA | 109.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.67 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|