C18H19N5O7S2 — CID 173422979
(4-methoxy-4-oxobut-2-enyl) (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-3-carboxylate (PubChem CID 173422979) has the molecular formula C18H19N5O7S2 and a molecular weight of 481.51 g/mol. Its IUPAC name is (4-methoxy-4-oxobut-2-enyl) (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-3-carboxylate.
| Compound Name | (4-methoxy-4-oxobut-2-enyl) (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-3-carboxylate |
|---|---|
| PubChem CID | 173422979 |
| Molecular Formula | C18H19N5O7S2 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.07 |
| IUPAC Name | (4-methoxy-4-oxobut-2-enyl) (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-3-carboxylate |
| SMILES | CON=C(C(=O)NC1C(=O)N2C=C(C(=O)OCC=CC(=O)OC)CS[C@H]12)c1csc(N)n1 |
| InChI | InChI=1S/C18H19N5O7S2/c1-28-11(24)4-3-5-30-17(27)9-6-23-15(26)13(16(23)31-7-9)21-14(25)12(22-29-2)10-8-32-18(19)20-10/h3-4,6,8,13,16H,5,7H2,1-2H3,(H2,19,20)(H,21,25)/t13?,16-/m1/s1 |
| InChIKey | QOCGFONCJQOVAG-FQNRMIAFSA-N |
| XLogP | -0.37 |
| TPSA | 162.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|