C16H20N6O4S2 — CID 89337687
(2Z)-2-(2-amino-1,3-thiazol-4-yl)-N-[(6R,7R)-3-[(dimethylamino)methyl]-2-formyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]-2-methoxyiminoacetamide (PubChem CID 89337687) has the molecular formula C16H20N6O4S2 and a molecular weight of 424.51 g/mol. Its IUPAC name is (2Z)-2-(2-amino-1,3-thiazol-4-yl)-N-[(6R,7R)-3-[(dimethylamino)methyl]-2-formyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]-2-methoxyiminoacetamide.
| Compound Name | (2Z)-2-(2-amino-1,3-thiazol-4-yl)-N-[(6R,7R)-3-[(dimethylamino)methyl]-2-formyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]-2-methoxyiminoacetamide |
|---|---|
| PubChem CID | 89337687 |
| Molecular Formula | C16H20N6O4S2 |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | (2Z)-2-(2-amino-1,3-thiazol-4-yl)-N-[(6R,7R)-3-[(dimethylamino)methyl]-2-formyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]-2-methoxyiminoacetamide |
| SMILES | CO/N=C(\C(=O)N[C@@H]1C(=O)N2C(C=O)=C(CN(C)C)CS[C@H]12)c1csc(N)n1 |
| InChI | InChI=1S/C16H20N6O4S2/c1-21(2)4-8-6-27-15-12(14(25)22(15)10(8)5-23)19-13(24)11(20-26-3)9-7-28-16(17)18-9/h5,7,12,15H,4,6H2,1-3H3,(H2,17,18)(H,19,24)/b20-11-/t12-,15-/m1/s1 |
| InChIKey | DARDSEOZJKCCFM-LBPKFYEDSA-N |
| XLogP | -0.51 |
| TPSA | 130.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|