C18H21N5O5S2 — CID 173423290
3-methylbut-2-enyl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-3-carboxylate (PubChem CID 173423290) has the molecular formula C18H21N5O5S2 and a molecular weight of 451.53 g/mol. Its IUPAC name is 3-methylbut-2-enyl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-3-carboxylate.
| Compound Name | 3-methylbut-2-enyl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-3-carboxylate |
|---|---|
| PubChem CID | 173423290 |
| Molecular Formula | C18H21N5O5S2 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | 3-methylbut-2-enyl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-3-carboxylate |
| SMILES | CON=C(C(=O)NC1C(=O)N2C=C(C(=O)OCC=C(C)C)CS[C@H]12)c1csc(N)n1 |
| InChI | InChI=1S/C18H21N5O5S2/c1-9(2)4-5-28-17(26)10-6-23-15(25)13(16(23)29-7-10)21-14(24)12(22-27-3)11-8-30-18(19)20-11/h4,6,8,13,16H,5,7H2,1-3H3,(H2,19,20)(H,21,24)/t13?,16-/m1/s1 |
| InChIKey | LWPDAQYCIPPNDD-FQNRMIAFSA-N |
| XLogP | 0.87 |
| TPSA | 136.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|