C37H32N6O3S3 — CID 88598768
2-methoxyimino-N-[(6S)-3-[2-(4-methyl-1,3-thiazol-5-yl)ethenyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetamide (PubChem CID 88598768) has the molecular formula C37H32N6O3S3 and a molecular weight of 704.90 g/mol. Its IUPAC name is 2-methoxyimino-N-[(6S)-3-[2-(4-methyl-1,3-thiazol-5-yl)ethenyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetamide.
| Compound Name | 2-methoxyimino-N-[(6S)-3-[2-(4-methyl-1,3-thiazol-5-yl)ethenyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 88598768 |
| Molecular Formula | C37H32N6O3S3 |
| Molecular Weight | 704.90 g/mol |
| Exact Mass | 704.17 |
| IUPAC Name | 2-methoxyimino-N-[(6S)-3-[2-(4-methyl-1,3-thiazol-5-yl)ethenyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetamide |
| SMILES | CON=C(C(=O)NC1C(=O)N2C=C(C=Cc3scnc3C)CS[C@@H]12)c1csc(NC(c2ccccc2)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C37H32N6O3S3/c1-24-30(49-23-38-24)19-18-25-20-43-34(45)32(35(43)47-21-25)40-33(44)31(42-46-2)29-22-48-36(39-29)41-37(26-12-6-3-7-13-26,27-14-8-4-9-15-27)28-16-10-5-11-17-28/h3-20,22-23,32,35H,21H2,1-2H3,(H,39,41)(H,40,44)/t32?,35-/m0/s1 |
| InChIKey | WKIHMCVFXISQCC-JXTSYGIPSA-N |
| XLogP | 6.66 |
| TPSA | 108.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.90 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|