C40H41N5O6S2 — CID 131721626
tert-butyl (6R,7R)-7-[[(2E)-2-methoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetyl]amino]-8-oxo-3-(oxolan-3-yl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 131721626) has the molecular formula C40H41N5O6S2 and a molecular weight of 751.93 g/mol. Its IUPAC name is tert-butyl (6R,7R)-7-[[(2E)-2-methoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetyl]amino]-8-oxo-3-(oxolan-3-yl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | tert-butyl (6R,7R)-7-[[(2E)-2-methoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetyl]amino]-8-oxo-3-(oxolan-3-yl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 131721626 |
| Molecular Formula | C40H41N5O6S2 |
| Molecular Weight | 751.93 g/mol |
| Exact Mass | 751.25 |
| IUPAC Name | tert-butyl (6R,7R)-7-[[(2E)-2-methoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetyl]amino]-8-oxo-3-(oxolan-3-yl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CO/N=C(/C(=O)N[C@@H]1C(=O)N2C(C(=O)OC(C)(C)C)=C(C3CCOC3)CS[C@H]12)c1csc(NC(c2ccccc2)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C40H41N5O6S2/c1-39(2,3)51-37(48)33-29(25-20-21-50-22-25)23-52-36-32(35(47)45(33)36)42-34(46)31(44-49-4)30-24-53-38(41-30)43-40(26-14-8-5-9-15-26,27-16-10-6-11-17-27)28-18-12-7-13-19-28/h5-19,24-25,32,36H,20-23H2,1-4H3,(H,41,43)(H,42,46)/b44-31+/t25?,32-,36-/m1/s1 |
| InChIKey | ULXDOTZEEJNRFR-AJDIRUKCSA-N |
| XLogP | 5.93 |
| TPSA | 131.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.93 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|