C39H41N5O5S2 — CID 54062101
tert-butyl 7-[[2-methoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetyl]amino]-8-oxo-3-propan-2-yl-4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 54062101) has the molecular formula C39H41N5O5S2 and a molecular weight of 723.92 g/mol. Its IUPAC name is tert-butyl 7-[[2-methoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetyl]amino]-8-oxo-3-propan-2-yl-4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | tert-butyl 7-[[2-methoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetyl]amino]-8-oxo-3-propan-2-yl-4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 54062101 |
| Molecular Formula | C39H41N5O5S2 |
| Molecular Weight | 723.92 g/mol |
| Exact Mass | 723.25 |
| IUPAC Name | tert-butyl 7-[[2-methoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetyl]amino]-8-oxo-3-propan-2-yl-4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CON=C(C(=O)NC1C(=O)N2C(C(=O)OC(C)(C)C)=C(C(C)C)SCC12)c1csc(NC(c2ccccc2)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C39H41N5O5S2/c1-24(2)33-32(36(47)49-38(3,4)5)44-29(23-50-33)31(35(44)46)41-34(45)30(43-48-6)28-22-51-37(40-28)42-39(25-16-10-7-11-17-25,26-18-12-8-13-19-26)27-20-14-9-15-21-27/h7-22,24,29,31H,23H2,1-6H3,(H,40,42)(H,41,45) |
| InChIKey | MAKZOUFGEHZATC-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 122.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.92 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|