C37H43N5O6SSi — CID 88631970
[(2R,3R)-1-[tert-butyl(dimethyl)silyl]-3-[[(2Z)-2-methoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetyl]amino]-4-oxoazetidin-2-yl]methyl methyl carbonate (PubChem CID 88631970) has the molecular formula C37H43N5O6SSi and a molecular weight of 713.93 g/mol. Its IUPAC name is [(2R,3R)-1-[tert-butyl(dimethyl)silyl]-3-[[(2Z)-2-methoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetyl]amino]-4-oxoazetidin-2-yl]methyl methyl carbonate.
| Compound Name | [(2R,3R)-1-[tert-butyl(dimethyl)silyl]-3-[[(2Z)-2-methoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetyl]amino]-4-oxoazetidin-2-yl]methyl methyl carbonate |
|---|---|
| PubChem CID | 88631970 |
| Molecular Formula | C37H43N5O6SSi |
| Molecular Weight | 713.93 g/mol |
| Exact Mass | 713.27 |
| IUPAC Name | [(2R,3R)-1-[tert-butyl(dimethyl)silyl]-3-[[(2Z)-2-methoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetyl]amino]-4-oxoazetidin-2-yl]methyl methyl carbonate |
| SMILES | CO/N=C(\C(=O)N[C@H]1C(=O)N([Si](C)(C)C(C)(C)C)[C@H]1COC(=O)OC)c1csc(NC(c2ccccc2)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C37H43N5O6SSi/c1-36(2,3)50(6,7)42-29(23-48-35(45)46-4)31(33(42)44)39-32(43)30(41-47-5)28-24-49-34(38-28)40-37(25-17-11-8-12-18-25,26-19-13-9-14-20-26)27-21-15-10-16-22-27/h8-22,24,29,31H,23H2,1-7H3,(H,38,40)(H,39,43)/b41-30-/t29-,31+/m0/s1 |
| InChIKey | LLQHXQOBULNMSB-WYSPEIPKSA-N |
| XLogP | 6.38 |
| TPSA | 131.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.93 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|