C31H29N9O3S — CID 139641649
N-[2-ethyl-4-oxo-1-(2H-tetrazol-5-yl)azetidin-3-yl]-2-methoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetamide (PubChem CID 139641649) has the molecular formula C31H29N9O3S and a molecular weight of 607.70 g/mol. Its IUPAC name is N-[2-ethyl-4-oxo-1-(2H-tetrazol-5-yl)azetidin-3-yl]-2-methoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-[2-ethyl-4-oxo-1-(2H-tetrazol-5-yl)azetidin-3-yl]-2-methoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 139641649 |
| Molecular Formula | C31H29N9O3S |
| Molecular Weight | 607.70 g/mol |
| Exact Mass | 607.21 |
| IUPAC Name | N-[2-ethyl-4-oxo-1-(2H-tetrazol-5-yl)azetidin-3-yl]-2-methoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetamide |
| SMILES | CCC1C(NC(=O)C(=NOC)c2csc(NC(c3ccccc3)(c3ccccc3)c3ccccc3)n2)C(=O)N1c1nn[nH]n1 |
| InChI | InChI=1S/C31H29N9O3S/c1-3-24-26(28(42)40(24)29-35-38-39-36-29)33-27(41)25(37-43-2)23-19-44-30(32-23)34-31(20-13-7-4-8-14-20,21-15-9-5-10-16-21)22-17-11-6-12-18-22/h4-19,24,26H,3H2,1-2H3,(H,32,34)(H,33,41)(H,35,36,38,39) |
| InChIKey | JDQROAOAWCRKIM-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 150.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.70 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|