C38H38N8O6S2 — CID 139637888
tert-butyl 3-[(carbamoylhydrazinylidene)methyl]-7-[[2-methoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetyl]amino]-8-oxo-4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 139637888) has the molecular formula C38H38N8O6S2 and a molecular weight of 766.91 g/mol. Its IUPAC name is tert-butyl 3-[(carbamoylhydrazinylidene)methyl]-7-[[2-methoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetyl]amino]-8-oxo-4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | tert-butyl 3-[(carbamoylhydrazinylidene)methyl]-7-[[2-methoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetyl]amino]-8-oxo-4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 139637888 |
| Molecular Formula | C38H38N8O6S2 |
| Molecular Weight | 766.91 g/mol |
| Exact Mass | 766.24 |
| IUPAC Name | tert-butyl 3-[(carbamoylhydrazinylidene)methyl]-7-[[2-methoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetyl]amino]-8-oxo-4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CON=C(C(=O)NC1C(=O)N2C(C(=O)OC(C)(C)C)=C(C=NNC(N)=O)SCC12)c1csc(NC(c2ccccc2)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C38H38N8O6S2/c1-37(2,3)52-34(49)31-28(20-40-44-35(39)50)53-22-27-30(33(48)46(27)31)42-32(47)29(45-51-4)26-21-54-36(41-26)43-38(23-14-8-5-9-15-23,24-16-10-6-11-17-24)25-18-12-7-13-19-25/h5-21,27,30H,22H2,1-4H3,(H,41,43)(H,42,47)(H3,39,44,50) |
| InChIKey | BTASTDFOPKAQAQ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 189.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.91 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|