C23H23N6O5S2+ — CID 131713028
1-[[(6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-cyclopent-2-en-1-yloxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl]pyridin-1-ium-4-carboxylic acid (PubChem CID 131713028) has the molecular formula C23H23N6O5S2+ and a molecular weight of 527.61 g/mol. Its IUPAC name is 1-[[(6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-cyclopent-2-en-1-yloxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl]pyridin-1-ium-4-carboxylic acid.
| Compound Name | 1-[[(6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-cyclopent-2-en-1-yloxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl]pyridin-1-ium-4-carboxylic acid |
|---|---|
| PubChem CID | 131713028 |
| Molecular Formula | C23H23N6O5S2+ |
| Molecular Weight | 527.61 g/mol |
| Exact Mass | 527.12 |
| IUPAC Name | 1-[[(6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-cyclopent-2-en-1-yloxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl]pyridin-1-ium-4-carboxylic acid |
| SMILES | Nc1nc(C(=NOC2C=CCC2)C(=O)NC2C(=O)N3C=C(C[n+]4ccc(C(=O)O)cc4)CS[C@H]23)cs1 |
| InChI | InChI=1S/C23H22N6O5S2/c24-23-25-16(12-36-23)17(27-34-15-3-1-2-4-15)19(30)26-18-20(31)29-10-13(11-35-21(18)29)9-28-7-5-14(6-8-28)22(32)33/h1,3,5-8,10,12,15,18,21H,2,4,9,11H2,(H3-,24,25,26,30,32,33)/p+1/t15?,18?,21-/m1/s1 |
| InChIKey | LLXAHDDZGRAWJD-ZYKWQNGHSA-O |
| XLogP | 1.13 |
| TPSA | 151.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.61 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|