C22H22N7O5S2+ — CID 88712813
1-[[(6R)-7-[[(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-cyclopent-2-en-1-yloxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl]pyridin-1-ium-4-carboxylic acid (PubChem CID 88712813) has the molecular formula C22H22N7O5S2+ and a molecular weight of 528.60 g/mol. Its IUPAC name is 1-[[(6R)-7-[[(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-cyclopent-2-en-1-yloxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl]pyridin-1-ium-4-carboxylic acid.
| Compound Name | 1-[[(6R)-7-[[(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-cyclopent-2-en-1-yloxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl]pyridin-1-ium-4-carboxylic acid |
|---|---|
| PubChem CID | 88712813 |
| Molecular Formula | C22H22N7O5S2+ |
| Molecular Weight | 528.60 g/mol |
| Exact Mass | 528.11 |
| IUPAC Name | 1-[[(6R)-7-[[(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-cyclopent-2-en-1-yloxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl]pyridin-1-ium-4-carboxylic acid |
| SMILES | Nc1nc(/C(=N/OC2C=CCC2)C(=O)NC2C(=O)N3C=C(C[n+]4ccc(C(=O)O)cc4)CS[C@H]23)ns1 |
| InChI | InChI=1S/C22H21N7O5S2/c23-22-25-17(27-36-22)15(26-34-14-3-1-2-4-14)18(30)24-16-19(31)29-10-12(11-35-20(16)29)9-28-7-5-13(6-8-28)21(32)33/h1,3,5-8,10,14,16,20H,2,4,9,11H2,(H3-,23,24,25,27,30,32,33)/p+1/b26-15-/t14?,16?,20-/m1/s1 |
| InChIKey | ZTKWXZJPBTVGGG-JQSMHETJSA-O |
| XLogP | 0.53 |
| TPSA | 163.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.60 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|