C19H19N7O5S2 — CID 172712617
2-[[1-(5-amino-1,2,4-thiadiazol-3-yl)-2-oxo-2-[[(6R)-8-oxo-3-(pyridin-1-ium-1-ylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]amino]ethylidene]amino]oxypropanoate (PubChem CID 172712617) has the molecular formula C19H19N7O5S2 and a molecular weight of 489.54 g/mol. Its IUPAC name is 2-[[1-(5-amino-1,2,4-thiadiazol-3-yl)-2-oxo-2-[[(6R)-8-oxo-3-(pyridin-1-ium-1-ylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]amino]ethylidene]amino]oxypropanoate.
| Compound Name | 2-[[1-(5-amino-1,2,4-thiadiazol-3-yl)-2-oxo-2-[[(6R)-8-oxo-3-(pyridin-1-ium-1-ylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]amino]ethylidene]amino]oxypropanoate |
|---|---|
| PubChem CID | 172712617 |
| Molecular Formula | C19H19N7O5S2 |
| Molecular Weight | 489.54 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | 2-[[1-(5-amino-1,2,4-thiadiazol-3-yl)-2-oxo-2-[[(6R)-8-oxo-3-(pyridin-1-ium-1-ylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]amino]ethylidene]amino]oxypropanoate |
| SMILES | CC(ON=C(C(=O)NC1C(=O)N2C=C(C[n+]3ccccc3)CS[C@H]12)c1nsc(N)n1)C(=O)[O-] |
| InChI | InChI=1S/C19H19N7O5S2/c1-10(18(29)30)31-23-12(14-22-19(20)33-24-14)15(27)21-13-16(28)26-8-11(9-32-17(13)26)7-25-5-3-2-4-6-25/h2-6,8,10,13,17H,7,9H2,1H3,(H3-,20,21,22,24,27,29,30)/t10?,13?,17-/m1/s1 |
| InChIKey | FLEXSCRIQARWFN-MOIAVMEXSA-N |
| XLogP | -1.75 |
| TPSA | 166.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.54 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|