C18H15F2N7O5S2 — CID 88680048
(6R)-7-[[(2E)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-(difluoromethoxyimino)acetyl]amino]-8-oxo-3-(pyridin-1-ium-1-ylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 88680048) has the molecular formula C18H15F2N7O5S2 and a molecular weight of 511.49 g/mol. Its IUPAC name is (6R)-7-[[(2E)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-(difluoromethoxyimino)acetyl]amino]-8-oxo-3-(pyridin-1-ium-1-ylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | (6R)-7-[[(2E)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-(difluoromethoxyimino)acetyl]amino]-8-oxo-3-(pyridin-1-ium-1-ylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88680048 |
| Molecular Formula | C18H15F2N7O5S2 |
| Molecular Weight | 511.49 g/mol |
| Exact Mass | 511.05 |
| IUPAC Name | (6R)-7-[[(2E)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-(difluoromethoxyimino)acetyl]amino]-8-oxo-3-(pyridin-1-ium-1-ylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | Nc1nc(/C(=N\OC(F)F)C(=O)NC2C(=O)N3C(C(=O)[O-])=C(C[n+]4ccccc4)CS[C@H]23)ns1 |
| InChI | InChI=1S/C18H15F2N7O5S2/c19-17(20)32-24-9(12-23-18(21)34-25-12)13(28)22-10-14(29)27-11(16(30)31)8(7-33-15(10)27)6-26-4-2-1-3-5-26/h1-5,10,15,17H,6-7H2,(H3-,21,22,23,25,28,30,31)/b24-9+/t10?,15-/m1/s1 |
| InChIKey | XLHADTYYSYAJMX-ILWYYNNCSA-N |
| XLogP | -1.54 |
| TPSA | 166.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.49 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|