C19H19N7O5S2 — CID 88716836
(6S)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-methoxyiminoacetyl]amino]-3-[(3-methylpyridin-1-ium-1-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 88716836) has the molecular formula C19H19N7O5S2 and a molecular weight of 489.54 g/mol. Its IUPAC name is (6S)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-methoxyiminoacetyl]amino]-3-[(3-methylpyridin-1-ium-1-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | (6S)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-methoxyiminoacetyl]amino]-3-[(3-methylpyridin-1-ium-1-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88716836 |
| Molecular Formula | C19H19N7O5S2 |
| Molecular Weight | 489.54 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | (6S)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-methoxyiminoacetyl]amino]-3-[(3-methylpyridin-1-ium-1-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CON=C(C(=O)NC1C(=O)N2C(C(=O)[O-])=C(C[n+]3cccc(C)c3)CS[C@@H]12)c1nsc(N)n1 |
| InChI | InChI=1S/C19H19N7O5S2/c1-9-4-3-5-25(6-9)7-10-8-32-17-12(16(28)26(17)13(10)18(29)30)21-15(27)11(23-31-2)14-22-19(20)33-24-14/h3-6,12,17H,7-8H2,1-2H3,(H3-,20,21,22,24,27,29,30)/t12?,17-/m0/s1 |
| InChIKey | LWXWBQWIPNMRHS-TYJDENFWSA-N |
| XLogP | -1.83 |
| TPSA | 166.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.54 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|