C22H23N7O5S — CID 88707377
(6R)-7-[[(2E)-2-(4-aminopyrimidin-2-yl)-2-ethoxyiminoacetyl]amino]-3-[(3-methylpyridin-1-ium-1-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 88707377) has the molecular formula C22H23N7O5S and a molecular weight of 497.54 g/mol. Its IUPAC name is (6R)-7-[[(2E)-2-(4-aminopyrimidin-2-yl)-2-ethoxyiminoacetyl]amino]-3-[(3-methylpyridin-1-ium-1-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | (6R)-7-[[(2E)-2-(4-aminopyrimidin-2-yl)-2-ethoxyiminoacetyl]amino]-3-[(3-methylpyridin-1-ium-1-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88707377 |
| Molecular Formula | C22H23N7O5S |
| Molecular Weight | 497.54 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | (6R)-7-[[(2E)-2-(4-aminopyrimidin-2-yl)-2-ethoxyiminoacetyl]amino]-3-[(3-methylpyridin-1-ium-1-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CCO/N=C(/C(=O)NC1C(=O)N2C(C(=O)[O-])=C(C[n+]3cccc(C)c3)CS[C@H]12)c1nccc(N)n1 |
| InChI | InChI=1S/C22H23N7O5S/c1-3-34-27-15(18-24-7-6-14(23)25-18)19(30)26-16-20(31)29-17(22(32)33)13(11-35-21(16)29)10-28-8-4-5-12(2)9-28/h4-9,16,21H,3,10-11H2,1-2H3,(H3-,23,24,25,26,30,32,33)/b27-15+/t16?,21-/m1/s1 |
| InChIKey | CXCTZAPTSCCDEE-YFLVBUCTSA-N |
| XLogP | -1.50 |
| TPSA | 166.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.54 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|