C20H19N7O7S2 — CID 154417634
(6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-ethoxyiminoacetyl]amino]-3-[(4-carboxypyridin-1-ium-1-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 154417634) has the molecular formula C20H19N7O7S2 and a molecular weight of 533.55 g/mol. Its IUPAC name is (6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-ethoxyiminoacetyl]amino]-3-[(4-carboxypyridin-1-ium-1-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | (6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-ethoxyiminoacetyl]amino]-3-[(4-carboxypyridin-1-ium-1-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 154417634 |
| Molecular Formula | C20H19N7O7S2 |
| Molecular Weight | 533.55 g/mol |
| Exact Mass | 533.08 |
| IUPAC Name | (6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-ethoxyiminoacetyl]amino]-3-[(4-carboxypyridin-1-ium-1-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CCON=C(C(=O)NC1C(=O)N2C(C(=O)[O-])=C(C[n+]3ccc(C(=O)O)cc3)CS[C@H]12)c1nsc(N)n1 |
| InChI | InChI=1S/C20H19N7O7S2/c1-2-34-24-11(14-23-20(21)36-25-14)15(28)22-12-16(29)27-13(19(32)33)10(8-35-17(12)27)7-26-5-3-9(4-6-26)18(30)31/h3-6,12,17H,2,7-8H2,1H3,(H4-,21,22,23,25,28,30,31,32,33)/t12?,17-/m1/s1 |
| InChIKey | DGYYIPIGTRYMTR-RGUGMKFQSA-N |
| XLogP | -2.05 |
| TPSA | 204.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.55 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|