C20H19N8O5S2+ — CID 88767003
(6R)-7-[[(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-ethoxyiminoacetyl]amino]-3-[(4-cyanopyridin-1-ium-1-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88767003) has the molecular formula C20H19N8O5S2+ and a molecular weight of 515.56 g/mol. Its IUPAC name is (6R)-7-[[(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-ethoxyiminoacetyl]amino]-3-[(4-cyanopyridin-1-ium-1-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R)-7-[[(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-ethoxyiminoacetyl]amino]-3-[(4-cyanopyridin-1-ium-1-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88767003 |
| Molecular Formula | C20H19N8O5S2+ |
| Molecular Weight | 515.56 g/mol |
| Exact Mass | 515.09 |
| IUPAC Name | (6R)-7-[[(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-ethoxyiminoacetyl]amino]-3-[(4-cyanopyridin-1-ium-1-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CCO/N=C(\C(=O)NC1C(=O)N2C(C(=O)O)=C(C[n+]3ccc(C#N)cc3)CS[C@H]12)c1nsc(N)n1 |
| InChI | InChI=1S/C20H18N8O5S2/c1-2-33-25-12(15-24-20(22)35-26-15)16(29)23-13-17(30)28-14(19(31)32)11(9-34-18(13)28)8-27-5-3-10(7-21)4-6-27/h3-6,13,18H,2,8-9H2,1H3,(H3-,22,23,24,26,29,31,32)/p+1/b25-12-/t13?,18-/m1/s1 |
| InChIKey | BKGXYBZIGAJDIU-PONCMUIOSA-O |
| XLogP | -0.54 |
| TPSA | 187.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.56 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|