C20H22N7O5S2+ — CID 154417637
(6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-ethoxyiminoacetyl]amino]-3-[(3-methylpyridin-1-ium-1-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 154417637) has the molecular formula C20H22N7O5S2+ and a molecular weight of 504.57 g/mol. Its IUPAC name is (6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-ethoxyiminoacetyl]amino]-3-[(3-methylpyridin-1-ium-1-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-ethoxyiminoacetyl]amino]-3-[(3-methylpyridin-1-ium-1-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 154417637 |
| Molecular Formula | C20H22N7O5S2+ |
| Molecular Weight | 504.57 g/mol |
| Exact Mass | 504.11 |
| IUPAC Name | (6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-ethoxyiminoacetyl]amino]-3-[(3-methylpyridin-1-ium-1-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CCON=C(C(=O)NC1C(=O)N2C(C(=O)O)=C(C[n+]3cccc(C)c3)CS[C@H]12)c1nsc(N)n1 |
| InChI | InChI=1S/C20H21N7O5S2/c1-3-32-24-12(15-23-20(21)34-25-15)16(28)22-13-17(29)27-14(19(30)31)11(9-33-18(13)27)8-26-6-4-5-10(2)7-26/h4-7,13,18H,3,8-9H2,1-2H3,(H3-,21,22,23,25,28,30,31)/p+1/t13?,18-/m1/s1 |
| InChIKey | WGAOTHRMAVYRED-PQJIZZRHSA-O |
| XLogP | -0.10 |
| TPSA | 163.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.57 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|