C18H19N8O5S2+ — CID 54267152
(6S)-3-[(3-aminopyridin-1-ium-1-yl)methyl]-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 54267152) has the molecular formula C18H19N8O5S2+ and a molecular weight of 491.54 g/mol. Its IUPAC name is (6S)-3-[(3-aminopyridin-1-ium-1-yl)methyl]-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S)-3-[(3-aminopyridin-1-ium-1-yl)methyl]-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 54267152 |
| Molecular Formula | C18H19N8O5S2+ |
| Molecular Weight | 491.54 g/mol |
| Exact Mass | 491.09 |
| IUPAC Name | (6S)-3-[(3-aminopyridin-1-ium-1-yl)methyl]-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CON=C(C(=O)NC1C(=O)N2C(C(=O)O)=C(C[n+]3cccc(N)c3)CS[C@@H]12)c1nsc(N)n1 |
| InChI | InChI=1S/C18H18N8O5S2/c1-31-23-10(13-22-18(20)33-24-13)14(27)21-11-15(28)26-12(17(29)30)8(7-32-16(11)26)5-25-4-2-3-9(19)6-25/h2-4,6,11,16H,5,7,19H2,1H3,(H3-,20,21,22,24,27,29,30)/p+1/t11?,16-/m0/s1 |
| InChIKey | RHOLWUVQYWUIQK-NBFOKTCDSA-O |
| XLogP | -1.22 |
| TPSA | 190.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.54 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|