C21H24N7O5S2+ — CID 54029912
(6S)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-ethoxyiminoacetyl]amino]-3-[(3-ethylpyridin-1-ium-1-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 54029912) has the molecular formula C21H24N7O5S2+ and a molecular weight of 518.60 g/mol. Its IUPAC name is (6S)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-ethoxyiminoacetyl]amino]-3-[(3-ethylpyridin-1-ium-1-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-ethoxyiminoacetyl]amino]-3-[(3-ethylpyridin-1-ium-1-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 54029912 |
| Molecular Formula | C21H24N7O5S2+ |
| Molecular Weight | 518.60 g/mol |
| Exact Mass | 518.13 |
| IUPAC Name | (6S)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-ethoxyiminoacetyl]amino]-3-[(3-ethylpyridin-1-ium-1-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CCON=C(C(=O)NC1C(=O)N2C(C(=O)O)=C(C[n+]3cccc(CC)c3)CS[C@@H]12)c1nsc(N)n1 |
| InChI | InChI=1S/C21H23N7O5S2/c1-3-11-6-5-7-27(8-11)9-12-10-34-19-14(18(30)28(19)15(12)20(31)32)23-17(29)13(25-33-4-2)16-24-21(22)35-26-16/h5-8,14,19H,3-4,9-10H2,1-2H3,(H3-,22,23,24,26,29,31,32)/p+1/t14?,19-/m0/s1 |
| InChIKey | LEVRHDVBEBYGEY-PKDNWHCCSA-O |
| XLogP | 0.15 |
| TPSA | 163.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.60 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|