C20H17N7O6S2 — CID 88679211
(6R)-7-[[(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-methoxyiminoacetyl]amino]-3-(furo[2,3-b]pyridin-7-ium-7-ylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 88679211) has the molecular formula C20H17N7O6S2 and a molecular weight of 515.53 g/mol. Its IUPAC name is (6R)-7-[[(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-methoxyiminoacetyl]amino]-3-(furo[2,3-b]pyridin-7-ium-7-ylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | (6R)-7-[[(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-methoxyiminoacetyl]amino]-3-(furo[2,3-b]pyridin-7-ium-7-ylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88679211 |
| Molecular Formula | C20H17N7O6S2 |
| Molecular Weight | 515.53 g/mol |
| Exact Mass | 515.07 |
| IUPAC Name | (6R)-7-[[(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-methoxyiminoacetyl]amino]-3-(furo[2,3-b]pyridin-7-ium-7-ylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CO/N=C(\C(=O)NC1C(=O)N2C(C(=O)[O-])=C(C[n+]3cccc4ccoc43)CS[C@H]12)c1nsc(N)n1 |
| InChI | InChI=1S/C20H17N7O6S2/c1-32-24-11(14-23-20(21)35-25-14)15(28)22-12-16(29)27-13(19(30)31)10(8-34-18(12)27)7-26-5-2-3-9-4-6-33-17(9)26/h2-6,12,18H,7-8H2,1H3,(H3-,21,22,23,25,28,30,31)/b24-11-/t12?,18-/m1/s1 |
| InChIKey | UNXYNYLJKMXCMM-NABSWWSISA-N |
| XLogP | -1.39 |
| TPSA | 179.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.53 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|