C18H19N5O5S2 — CID 88702227
(6R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-cyclohex-2-en-1-yloxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88702227) has the molecular formula C18H19N5O5S2 and a molecular weight of 449.51 g/mol. Its IUPAC name is (6R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-cyclohex-2-en-1-yloxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-cyclohex-2-en-1-yloxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88702227 |
| Molecular Formula | C18H19N5O5S2 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | (6R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-cyclohex-2-en-1-yloxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | Nc1nc(/C(=N/OC2C=CCCC2)C(=O)NC2C(=O)N3C(C(=O)O)=CCS[C@H]23)cs1 |
| InChI | InChI=1S/C18H19N5O5S2/c19-18-20-10(8-30-18)12(22-28-9-4-2-1-3-5-9)14(24)21-13-15(25)23-11(17(26)27)6-7-29-16(13)23/h2,4,6,8-9,13,16H,1,3,5,7H2,(H2,19,20)(H,21,24)(H,26,27)/b22-12-/t9?,13?,16-/m1/s1 |
| InChIKey | MKVGBJKWFNPIOB-SEWAJAMTSA-N |
| XLogP | 0.92 |
| TPSA | 147.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|