C19H20N7O7S2+ — CID 88764725
1-[[(6R)-7-[[(2Z)-2-(3-amino-2H-1,2,4-thiadiazol-3-yl)-2-(carboxymethoxyimino)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl]pyridin-1-ium-4-carboxylic acid (PubChem CID 88764725) has the molecular formula C19H20N7O7S2+ and a molecular weight of 522.55 g/mol. Its IUPAC name is 1-[[(6R)-7-[[(2Z)-2-(3-amino-2H-1,2,4-thiadiazol-3-yl)-2-(carboxymethoxyimino)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl]pyridin-1-ium-4-carboxylic acid.
| Compound Name | 1-[[(6R)-7-[[(2Z)-2-(3-amino-2H-1,2,4-thiadiazol-3-yl)-2-(carboxymethoxyimino)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl]pyridin-1-ium-4-carboxylic acid |
|---|---|
| PubChem CID | 88764725 |
| Molecular Formula | C19H20N7O7S2+ |
| Molecular Weight | 522.55 g/mol |
| Exact Mass | 522.09 |
| IUPAC Name | 1-[[(6R)-7-[[(2Z)-2-(3-amino-2H-1,2,4-thiadiazol-3-yl)-2-(carboxymethoxyimino)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl]pyridin-1-ium-4-carboxylic acid |
| SMILES | NC1(/C(=N/OCC(=O)O)C(=O)NC2C(=O)N3C=C(C[n+]4ccc(C(=O)O)cc4)CS[C@H]23)N=CSN1 |
| InChI | InChI=1S/C19H19N7O7S2/c20-19(21-9-35-24-19)14(23-33-7-12(27)28)15(29)22-13-16(30)26-6-10(8-34-17(13)26)5-25-3-1-11(2-4-25)18(31)32/h1-4,6,9,13,17,24H,5,7-8,20H2,(H2-,22,27,28,29,31,32)/p+1/b23-14+/t13?,17-,19?/m1/s1 |
| InChIKey | AZCQZRDWUCZCCA-SXDRMSMBSA-O |
| XLogP | -1.69 |
| TPSA | 199.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.55 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|