C14H14N3O4S+ — CID 88801798
1-[[(6R,7R)-7-formamido-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl]pyridin-1-ium-4-carboxylic acid (PubChem CID 88801798) has the molecular formula C14H14N3O4S+ and a molecular weight of 320.35 g/mol. Its IUPAC name is 1-[[(6R,7R)-7-formamido-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl]pyridin-1-ium-4-carboxylic acid.
| Compound Name | 1-[[(6R,7R)-7-formamido-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl]pyridin-1-ium-4-carboxylic acid |
|---|---|
| PubChem CID | 88801798 |
| Molecular Formula | C14H14N3O4S+ |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 1-[[(6R,7R)-7-formamido-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl]pyridin-1-ium-4-carboxylic acid |
| SMILES | O=CN[C@@H]1C(=O)N2C=C(C[n+]3ccc(C(=O)O)cc3)CS[C@H]12 |
| InChI | InChI=1S/C14H13N3O4S/c18-8-15-11-12(19)17-6-9(7-22-13(11)17)5-16-3-1-10(2-4-16)14(20)21/h1-4,6,8,11,13H,5,7H2,(H-,15,18,20,21)/p+1/t11-,13-/m1/s1 |
| InChIKey | BOFPXEOCRXCLRZ-DGCLKSJQSA-O |
| XLogP | -0.41 |
| TPSA | 90.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|