C12H14ClN3OS — CID 159891990
(6R,7R)-7-amino-3-(pyridin-1-ium-1-ylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-en-8-one chloride (PubChem CID 159891990) has the molecular formula C12H14ClN3OS and a molecular weight of 283.78 g/mol. Its IUPAC name is (6R,7R)-7-amino-3-(pyridin-1-ium-1-ylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-en-8-one chloride.
| Compound Name | (6R,7R)-7-amino-3-(pyridin-1-ium-1-ylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-en-8-one chloride |
|---|---|
| PubChem CID | 159891990 |
| Molecular Formula | C12H14ClN3OS |
| Molecular Weight | 283.78 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | (6R,7R)-7-amino-3-(pyridin-1-ium-1-ylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-en-8-one chloride |
| SMILES | N[C@@H]1C(=O)N2C=C(C[n+]3ccccc3)CS[C@H]12.[Cl-] |
| InChI | InChI=1S/C12H14N3OS.ClH/c13-10-11(16)15-7-9(8-17-12(10)15)6-14-4-2-1-3-5-14;/h1-5,7,10,12H,6,8,13H2;1H/q+1;/p-1/t10-,12-;/m1./s1 |
| InChIKey | NUWFEICAYKBVKJ-MHDYBILJSA-M |
| XLogP | -2.90 |
| TPSA | 50.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.78 |
| LogP ≤ 5 | -2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|