C8H9BrN2O3S — CID 22827995
(6S)-7-amino-3-(bromomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-7-carboxylic acid (PubChem CID 22827995) has the molecular formula C8H9BrN2O3S and a molecular weight of 293.14 g/mol. Its IUPAC name is (6S)-7-amino-3-(bromomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-7-carboxylic acid.
| Compound Name | (6S)-7-amino-3-(bromomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-7-carboxylic acid |
|---|---|
| PubChem CID | 22827995 |
| Molecular Formula | C8H9BrN2O3S |
| Molecular Weight | 293.14 g/mol |
| Exact Mass | 291.95 |
| IUPAC Name | (6S)-7-amino-3-(bromomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-7-carboxylic acid |
| SMILES | NC1(C(=O)O)C(=O)N2C=C(CBr)CS[C@H]21 |
| InChI | InChI=1S/C8H9BrN2O3S/c9-1-4-2-11-5(12)8(10,7(13)14)6(11)15-3-4/h2,6H,1,3,10H2,(H,13,14)/t6-,8?/m0/s1 |
| InChIKey | QTYMSYCZBVWNIW-UUEFVBAFSA-N |
| XLogP | -0.04 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.14 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|