C10H10N2O5S2 — CID 88752313
(6S,7R)-7-amino-3-(carboxymethyl)-7-methanethioyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88752313) has the molecular formula C10H10N2O5S2 and a molecular weight of 302.33 g/mol. Its IUPAC name is (6S,7R)-7-amino-3-(carboxymethyl)-7-methanethioyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S,7R)-7-amino-3-(carboxymethyl)-7-methanethioyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88752313 |
| Molecular Formula | C10H10N2O5S2 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.00 |
| IUPAC Name | (6S,7R)-7-amino-3-(carboxymethyl)-7-methanethioyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | N[C@]1(C=S)C(=O)N2C(C(=O)O)=C(CC(=O)O)CS[C@H]21 |
| InChI | InChI=1S/C10H10N2O5S2/c11-10(3-18)8(17)12-6(7(15)16)4(1-5(13)14)2-19-9(10)12/h3,9H,1-2,11H2,(H,13,14)(H,15,16)/t9-,10+/m0/s1 |
| InChIKey | GEKOCGCOJCMUOB-VHSXEESVSA-N |
| XLogP | -0.59 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|