C9H10N2O4S — CID 163965200
(6R,7R)-7-amino-8-oxo-3-(2-oxoethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 163965200) has the molecular formula C9H10N2O4S and a molecular weight of 242.26 g/mol. Its IUPAC name is (6R,7R)-7-amino-8-oxo-3-(2-oxoethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7R)-7-amino-8-oxo-3-(2-oxoethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 163965200 |
| Molecular Formula | C9H10N2O4S |
| Molecular Weight | 242.26 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | (6R,7R)-7-amino-8-oxo-3-(2-oxoethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | N[C@@H]1C(=O)N2C(C(=O)O)=C(CC=O)CS[C@H]12 |
| InChI | InChI=1S/C9H10N2O4S/c10-5-7(13)11-6(9(14)15)4(1-2-12)3-16-8(5)11/h2,5,8H,1,3,10H2,(H,14,15)/t5-,8-/m1/s1 |
| InChIKey | SLBPVHCQACHNDJ-SVGQVSJJSA-N |
| XLogP | -0.84 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.26 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|